cas: 959-33-1 — see every product listed under this CAS number, including other names
(E)-3-(4-Methoxyphenyl)-1-phenylprop-2-en-1-one (CAS 959-33-1) is a chemical reagent available from Chemat. Available pack sizes: 5g, 25g, 100g, 500g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F092495-5G |
| cas | 959-33-1 |
| size | 5g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 5g | 164.54 Pln | |
| Fluorochem | 25g | 372.80 Pln | |
| Fluorochem | 100g | 1080.89 Pln | |
| Fluorochem | 500g | 4246.44 Pln |
| delivery time | 3-4 weeks |
|---|
(E)-3-(4-methoxyphenyl)-1-phenylprop-2-en-1-one (CAS 959-33-1) is a chemical compound with the molecular formula C16H14O2 and a molecular weight of 238.28 g/mol. IUPAC name: (E)-3-(4-methoxyphenyl)-1-phenylprop-2-en-1-one. InChIKey: XUFXKBJMCRJATM-FMIVXFBMSA-N.
| Molecular formula | C16H14O2 |
|---|---|
| Molecular weight | 238.28 g/mol |
| IUPAC name | (E)-3-(4-methoxyphenyl)-1-phenylprop-2-en-1-one |
| InChIKey | XUFXKBJMCRJATM-FMIVXFBMSA-N |
| SMILES | COC1=CC=C(C=C1)/C=C/C(=O)C2=CC=CC=C2 |
Computed by PubChem (NCBI)