cas: 959-33-1 — see every product listed under this CAS number, including other names
4-METHOXYCHALCONE 98% (CAS 959-33-1) is a chemical reagent available from Chemat. Available pack sizes: 5g, 25g, 100g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A349458-5g |
| cas | 959-33-1 |
| size | 5g |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 5g | 209.06 Pln | |
| Ambeed | 25g | 370.38 Pln | |
| Ambeed | 100g | 960.00 Pln |
| purity | 98% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A349458 |
(E)-3-(4-methoxyphenyl)-1-phenylprop-2-en-1-one (CAS 959-33-1) is a chemical compound with the molecular formula C16H14O2 and a molecular weight of 238.28 g/mol. IUPAC name: (E)-3-(4-methoxyphenyl)-1-phenylprop-2-en-1-one. InChIKey: XUFXKBJMCRJATM-FMIVXFBMSA-N.
| Molecular formula | C16H14O2 |
|---|---|
| Molecular weight | 238.28 g/mol |
| IUPAC name | (E)-3-(4-methoxyphenyl)-1-phenylprop-2-en-1-one |
| InChIKey | XUFXKBJMCRJATM-FMIVXFBMSA-N |
| SMILES | COC1=CC=C(C=C1)/C=C/C(=O)C2=CC=CC=C2 |
Computed by PubChem (NCBI)