CAS 2680616-14-0 is the registry number for 2-(2,4,6-Trifluorophenyl)ethan-1-amine hydrochloride, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 100mg.
2-(2,4,6-trifluorophenyl)ethanamine;hydrochloride (CAS 2680616-14-0) is a chemical compound with the molecular formula C8H9ClF3N and a molecular weight of 211.61 g/mol. IUPAC name: 2-(2,4,6-trifluorophenyl)ethanamine;hydrochloride. InChIKey: FZBIYYKRNJHUPO-UHFFFAOYSA-N.
| Molecular formula | C8H9ClF3N |
|---|---|
| Molecular weight | 211.61 g/mol |
| IUPAC name | 2-(2,4,6-trifluorophenyl)ethanamine;hydrochloride |
| InChIKey | FZBIYYKRNJHUPO-UHFFFAOYSA-N |
| SMILES | C1=C(C=C(C(=C1F)CCN)F)F.Cl |
Computed by PubChem (NCBI)