CAS 2719778-73-9 is the registry number for (R)-2,2-Difluoro-1-(3-fluorophenyl)ethan-1-amine hydrochloride, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
(1R)-2,2-difluoro-1-(3-fluorophenyl)ethanamine;hydrochloride (CAS 2719778-73-9) is a chemical compound with the molecular formula C8H9ClF3N and a molecular weight of 211.61 g/mol. IUPAC name: (1R)-2,2-difluoro-1-(3-fluorophenyl)ethanamine;hydrochloride. InChIKey: KKXCQBSWKPXTSF-OGFXRTJISA-N.
| Molecular formula | C8H9ClF3N |
|---|---|
| Molecular weight | 211.61 g/mol |
| IUPAC name | (1R)-2,2-difluoro-1-(3-fluorophenyl)ethanamine;hydrochloride |
| InChIKey | KKXCQBSWKPXTSF-OGFXRTJISA-N |
| SMILES | C1=CC(=CC(=C1)F)[C@H](C(F)F)N.Cl |
Computed by PubChem (NCBI)