CAS 1276039-66-7 appears in our catalog under these names: (R)-1-(2,4,6-Trifluorophenyl)ethan-1-amine hydrochloride, 97%, (R)-1-(2,4,6-Trifluorophenyl)ethanamine hydrochloride, 97%, 97%, (R)-1-(2,4,6-Trifluorophenyl)ethanamine hydrochloride, 97%. Offered by: AmBeed, Chemat, Fluorochem. Available pack sizes: 5g, 100mg, 250mg, 1g.
(1R)-1-(2,4,6-trifluorophenyl)ethanamine;hydrochloride (CAS 1276039-66-7) is a chemical compound with the molecular formula C8H9ClF3N and a molecular weight of 211.61 g/mol. IUPAC name: (1R)-1-(2,4,6-trifluorophenyl)ethanamine;hydrochloride. InChIKey: DYOIYJYFXYTTAY-PGMHMLKASA-N.
| Molecular formula | C8H9ClF3N |
|---|---|
| Molecular weight | 211.61 g/mol |
| IUPAC name | (1R)-1-(2,4,6-trifluorophenyl)ethanamine;hydrochloride |
| InChIKey | DYOIYJYFXYTTAY-PGMHMLKASA-N |
| SMILES | C[C@H](C1=C(C=C(C=C1F)F)F)N.Cl |
Computed by PubChem (NCBI)