Products 23984-80-7
CAS 23984-80-7 appears in our catalog under these names: 2-Methyl-4-(trifluoromethyl)aniline hydrochloride, 95%, 2-Methyl-4-(trifluoromethyl)aniline hydrochloride. Offered by: Combi-blocks, Biosynth. Available pack sizes: 5g, 1g.
2-methyl-4-(trifluoromethyl)aniline;hydrochloride (CAS 23984-80-7) is a chemical compound with the molecular formula C8H9ClF3N and a molecular weight of 211.61 g/mol. IUPAC name: 2-methyl-4-(trifluoromethyl)aniline;hydrochloride. InChIKey: CUKDRFZGHLCFHT-UHFFFAOYSA-N.
| Molecular formula | C8H9ClF3N |
|---|---|
| Molecular weight | 211.61 g/mol |
| IUPAC name | 2-methyl-4-(trifluoromethyl)aniline;hydrochloride |
| InChIKey | CUKDRFZGHLCFHT-UHFFFAOYSA-N |
| SMILES | CC1=C(C=CC(=C1)C(F)(F)F)N.Cl |
Computed by PubChem (NCBI)