Products 103981-82-4
CAS 103981-82-4 is the registry number for 3-methyl-5-(trifluoromethyl)aniline hydrochloride, 95%. Offered by: Combi-blocks. Available pack sizes: 10g, 5g, 1g.
3-methyl-5-(trifluoromethyl)aniline;hydrochloride (CAS 103981-82-4) is a chemical compound with the molecular formula C8H9ClF3N and a molecular weight of 211.61 g/mol. IUPAC name: 3-methyl-5-(trifluoromethyl)aniline;hydrochloride. InChIKey: LHEVSDZEPWDUGK-UHFFFAOYSA-N.
| Molecular formula | C8H9ClF3N |
|---|---|
| Molecular weight | 211.61 g/mol |
| IUPAC name | 3-methyl-5-(trifluoromethyl)aniline;hydrochloride |
| InChIKey | LHEVSDZEPWDUGK-UHFFFAOYSA-N |
| SMILES | CC1=CC(=CC(=C1)N)C(F)(F)F.Cl |
Computed by PubChem (NCBI)