cas: 1045712-21-7 — see every product listed under this CAS number, including other names
(R)-2-Amino-2-(2-chlorophenyl)acetic acid hydrochloride, 98% (CAS 1045712-21-7) is a chemical reagent available from Chemat. Available pack sizes: 50mg, 100mg, 250mg, 500mg, 1g, 2.5g, 5g, 10g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F679132-50MG |
| cas | 1045712-21-7 |
| size | 50mg |
| availability | In Stock China |
Ask us about this product — we're happy to help.
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 50mg | 154.13 Pln | |
| Fluorochem | 100mg | 164.54 Pln | |
| Fluorochem | 250mg | 174.96 Pln | |
| Fluorochem | 500mg | 180.16 Pln | |
| Fluorochem | 1g | 185.37 Pln | |
| Fluorochem | 2.5g | 372.80 Pln | |
| Fluorochem | 5g | 456.11 Pln | |
| Fluorochem | 10g | 836.18 Pln | |
| Fluorochem | 25g | 1466.17 Pln |
| purity | 98% |
|---|---|
| dual use | No |
| currency | EUR |
| delivery time | 2-3 weeks |
| category | Odczynniki chemiczne |
(2R)-2-amino-2-(2-chlorophenyl)acetic acid;hydrochloride (CAS 1045712-21-7) is a chemical compound with the molecular formula C8H9Cl2NO2 and a molecular weight of 222.07 g/mol. IUPAC name: (2R)-2-amino-2-(2-chlorophenyl)acetic acid;hydrochloride. InChIKey: GXBCSCVVIBVDFI-OGFXRTJISA-N.
| Molecular formula | C8H9Cl2NO2 |
|---|---|
| Molecular weight | 222.07 g/mol |
| IUPAC name | (2R)-2-amino-2-(2-chlorophenyl)acetic acid;hydrochloride |
| InChIKey | GXBCSCVVIBVDFI-OGFXRTJISA-N |
| SMILES | C1=CC=C(C(=C1)[C@H](C(=O)O)N)Cl.Cl |
Computed by PubChem (NCBI)