Products 1214196-70-9

CAS 1214196-70-9 appears in our catalog under these names: 2-Amino-2-(3-chlorophenyl)acetic acid hydrochloride, 95%, 2-Amino-2-(3-chlorophenyl)acetic acid hydrochloride, 95+%, 2-Amino-2-(3-chlorophenyl)acetic acid hydrochloride. Offered by: Combi-blocks, AmBeed, Biosynth. Available pack sizes: 10g, 1g, 5g, 250mg, 2,5g, 0,25g.

Structural formula: {0} (CAS {1})

2-amino-2-(3-chlorophenyl)acetic acid;hydrochloride (CAS 1214196-70-9) is a chemical compound with the molecular formula C8H9Cl2NO2 and a molecular weight of 222.07 g/mol. IUPAC name: 2-amino-2-(3-chlorophenyl)acetic acid;hydrochloride. InChIKey: YPIVOEYNISLYJX-UHFFFAOYSA-N.

Identity
Molecular formulaC8H9Cl2NO2
Molecular weight222.07 g/mol
IUPAC name2-amino-2-(3-chlorophenyl)acetic acid;hydrochloride
InChIKeyYPIVOEYNISLYJX-UHFFFAOYSA-N
SMILESC1=CC(=CC(=C1)Cl)C(C(=O)O)N.Cl

Computed by PubChem (NCBI)