CAS 174496-99-2 appears in our catalog under these names: 4-Chloro-nicotinic acid ethyl ester hydrochloride, 95%, 4-Chloro-Nicotinic acid ethyl ester hydrochloride, Ethyl 4-chloronicotinate hydrochloride 95%, 3-Pyridinecarboxylic acid, 4-chloro-, ethyl ester, hydrochloride (1:1), >95%, >95%, Ethyl 4-chloronicotinate hydrochloride. Offered by: Combi-blocks, Biosynth, Ambeed, Chemat, Fluorochem. Available pack sizes: 5g, 1g, 250mg, 100mg.
Ethyl 4-chloropyridine-3-carboxylate;hydrochloride (CAS 174496-99-2) is a chemical compound with the molecular formula C8H9Cl2NO2 and a molecular weight of 222.07 g/mol. IUPAC name: ethyl 4-chloropyridine-3-carboxylate;hydrochloride. InChIKey: LPFBXCWCEZYZOO-UHFFFAOYSA-N.
| Molecular formula | C8H9Cl2NO2 |
|---|---|
| Molecular weight | 222.07 g/mol |
| IUPAC name | ethyl 4-chloropyridine-3-carboxylate;hydrochloride |
| InChIKey | LPFBXCWCEZYZOO-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=C(C=CN=C1)Cl.Cl |
Computed by PubChem (NCBI)