CAS 855222-36-5 appears in our catalog under these names: 7-Chloro-2,3-dihydro-1,4-benzodioxin-6-amine hydrochloride, 95%, 7-chloro-2,3-dihydro-1,4-benzodioxin-6-amine Hydrochloride. Offered by: Combi-blocks, Biosynth. Available pack sizes: 5g, 1g, 250mg, 2,5g.
6-chloro-2,3-dihydro-1,4-benzodioxin-7-amine;hydrochloride (CAS 855222-36-5) is a chemical compound with the molecular formula C8H9Cl2NO2 and a molecular weight of 222.07 g/mol. IUPAC name: 6-chloro-2,3-dihydro-1,4-benzodioxin-7-amine;hydrochloride. InChIKey: YJIYYMLVZMYMSL-UHFFFAOYSA-N.
| Molecular formula | C8H9Cl2NO2 |
|---|---|
| Molecular weight | 222.07 g/mol |
| IUPAC name | 6-chloro-2,3-dihydro-1,4-benzodioxin-7-amine;hydrochloride |
| InChIKey | YJIYYMLVZMYMSL-UHFFFAOYSA-N |
| SMILES | C1COC2=C(O1)C=C(C(=C2)Cl)N.Cl |
Computed by PubChem (NCBI)