cas: 128404-37-5 — see every product listed under this CAS number, including other names
(S)-2,2,2-Trifluoro-1-phenylethylaminehydrochloride, 98% (CAS 128404-37-5) is a chemical reagent available from Chemat. Available pack sizes: 50mg, 100mg, 250mg, 500mg. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F093855-50MG |
| cas | 128404-37-5 |
| size | 50mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 50mg | 268.67 Pln | |
| Fluorochem | 100mg | 299.91 Pln | |
| Fluorochem | 250mg | 357.18 Pln | |
| Fluorochem | 500mg | 664.37 Pln |
| purity | 98% |
|---|---|
| delivery time | 3-4 weeks |
(1S)-2,2,2-trifluoro-1-phenylethanamine;hydrochloride (CAS 128404-37-5) is a chemical compound with the molecular formula C8H9ClF3N and a molecular weight of 211.61 g/mol. IUPAC name: (1S)-2,2,2-trifluoro-1-phenylethanamine;hydrochloride. InChIKey: LCQGOISHUDYBOS-FJXQXJEOSA-N.
| Molecular formula | C8H9ClF3N |
|---|---|
| Molecular weight | 211.61 g/mol |
| IUPAC name | (1S)-2,2,2-trifluoro-1-phenylethanamine;hydrochloride |
| InChIKey | LCQGOISHUDYBOS-FJXQXJEOSA-N |
| SMILES | C1=CC=C(C=C1)[C@@H](C(F)(F)F)N.Cl |
Computed by PubChem (NCBI)