cas: 63543-02-2 — see every product listed under this CAS number, including other names
[1,1'-Biphenyl]-4-ylhydrazine hydrochloride, 97%, 97% (CAS 63543-02-2) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11ECXD-100mg |
| cas | 63543-02-2 |
| size | 100mg |
| availability | 3g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 314.00 Pln | |
| Chemat | 250mg | 491.60 Pln | |
| Chemat | 1g | 1110.80 Pln |
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
(4-phenylphenyl)hydrazine;hydrochloride (CAS 63543-02-2) is a chemical compound with the molecular formula C12H13ClN2 and a molecular weight of 220.70 g/mol. IUPAC name: (4-phenylphenyl)hydrazine;hydrochloride. InChIKey: VQVHDZKZQXXRTH-UHFFFAOYSA-N.
| Molecular formula | C12H13ClN2 |
|---|---|
| Molecular weight | 220.70 g/mol |
| IUPAC name | (4-phenylphenyl)hydrazine;hydrochloride |
| InChIKey | VQVHDZKZQXXRTH-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C2=CC=C(C=C2)NN.Cl |
Computed by PubChem (NCBI)