Products 1170394-63-4
CAS 1170394-63-4 is the registry number for 1-[3-(Chloromethyl)phenyl]-3,5-dimethyl-1h-pyrazole hydrochloride, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.
1-[3-(chloromethyl)phenyl]-3,5-dimethylpyrazole (CAS 1170394-63-4) is a chemical compound with the molecular formula C12H13ClN2 and a molecular weight of 220.70 g/mol. IUPAC name: 1-[3-(chloromethyl)phenyl]-3,5-dimethylpyrazole. InChIKey: RXECFDHLQLJWMF-UHFFFAOYSA-N.
| Molecular formula | C12H13ClN2 |
|---|---|
| Molecular weight | 220.70 g/mol |
| IUPAC name | 1-[3-(chloromethyl)phenyl]-3,5-dimethylpyrazole |
| InChIKey | RXECFDHLQLJWMF-UHFFFAOYSA-N |
| SMILES | CC1=CC(=NN1C2=CC=CC(=C2)CCl)C |
Computed by PubChem (NCBI)