Products 1459205-36-7
CAS 1459205-36-7 appears in our catalog under these names: 1-(4-(Aminomethyl)phenyl)pyridin-1-ium chloride, 95%, 1–(4–(Aminomethyl)phenyl)pyridin–1–ium chloride, 1-(4-(Aminomethyl)phenyl)pyridin-1-ium chloride, 1-(4-(Aminomethyl)phenyl)pyridin-1-ium chloride 97%. Offered by: Combi-blocks, GLPBio, Biosynth, Ambeed, Fluorochem. Available pack sizes: 250mg, 5g, 1g, 100mg, 0,05g, 0,025g, 0,1g.
(4-pyridin-1-ium-1-ylphenyl)methanamine chloride (CAS 1459205-36-7) is a chemical compound with the molecular formula C12H13ClN2 and a molecular weight of 220.70 g/mol. IUPAC name: (4-pyridin-1-ium-1-ylphenyl)methanamine chloride. InChIKey: IWJUNRJXBXYTMP-UHFFFAOYSA-M.
| Molecular formula | C12H13ClN2 |
|---|---|
| Molecular weight | 220.70 g/mol |
| IUPAC name | (4-pyridin-1-ium-1-ylphenyl)methanamine chloride |
| InChIKey | IWJUNRJXBXYTMP-UHFFFAOYSA-M |
| SMILES | C1=CC=[N+](C=C1)C2=CC=C(C=C2)CN.[Cl-] |
Computed by PubChem (NCBI)