cas: 530-47-2 — see every product listed under this CAS number, including other names
1,1-Diphenylhydrazine hydrochloride, 97% (CAS 530-47-2) is a chemical reagent available from Chemat. Available pack sizes: 1g, 25G. Offered by: AmBeed, Sigma-Aldrich.
| brand | AmBeed |
|---|---|
| catalog number | A864578-1g |
| cas | 530-47-2 |
| size | 1g |
| availability | Synthetic Items: 0g |
| brand | size | price | |
|---|---|---|---|
| AmBeed | 1g | 239.26 Pln | |
| Sigma-Aldrich | 25G | 403.00 Pln |
| purity | 97% |
|---|---|
| delivery time | To be confirmed by Chemat |
1,1-diphenylhydrazine;hydrochloride (CAS 530-47-2) is a chemical compound with the molecular formula C12H13ClN2 and a molecular weight of 220.70 g/mol. IUPAC name: 1,1-diphenylhydrazine;hydrochloride. InChIKey: MIVUDWFNUOXEJM-UHFFFAOYSA-N.
| Molecular formula | C12H13ClN2 |
|---|---|
| Molecular weight | 220.70 g/mol |
| IUPAC name | 1,1-diphenylhydrazine;hydrochloride |
| InChIKey | MIVUDWFNUOXEJM-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)N(C2=CC=CC=C2)N.Cl |
Computed by PubChem (NCBI)