1,3-Dibromo-5-nitrobenzene 95%
cas: 6311-60-0 — see every product listed under this CAS number, including other names
1,3-Dibromo-5-nitrobenzene 95% (CAS 6311-60-0) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 10g, 25g, 100g, 500g, 1000g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A111519-1g |
| cas | 6311-60-0 |
| size | 1g |
Documents:
Safety Data Sheet (MSDS)
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 1g | 120.06 Pln | |
| Ambeed | 5g | 131.19 Pln | |
| Ambeed | 10g | 147.88 Pln | |
| Ambeed | 25g | 170.12 Pln | |
| Ambeed | 100g | 381.50 Pln | |
| Ambeed | 500g | 1160.25 Pln | |
| Ambeed | 1000g | 1922.31 Pln |
properties
| purity | 95% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A111519 |
1,3-dibromo-5-nitrobenzene (CAS 6311-60-0) is a chemical compound with the molecular formula C6H3Br2NO2 and a molecular weight of 280.90 g/mol. IUPAC name: 1,3-dibromo-5-nitrobenzene. InChIKey: ZWBHGBWABMAWOV-UHFFFAOYSA-N.
| Molecular formula | C6H3Br2NO2 |
|---|---|
| Molecular weight | 280.90 g/mol |
| IUPAC name | 1,3-dibromo-5-nitrobenzene |
| InChIKey | ZWBHGBWABMAWOV-UHFFFAOYSA-N |
| SMILES | C1=C(C=C(C=C1Br)Br)[N+](=O)[O-] |
Computed by PubChem (NCBI)