1,3-Dibromo-5-nitrobenzene, 97%
cas: 6311-60-0 — see every product listed under this CAS number, including other names
1,3-Dibromo-5-nitrobenzene, 97% (CAS 6311-60-0) is a chemical reagent available from Chemat. Available pack sizes: 5g, 10g, 25g, 50g, 100g, 500g, 1kg. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F224210-5G |
| cas | 6311-60-0 |
| size | 5g |
Documents:
Safety Data Sheet (MSDS)
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 5g | 81.24 Pln | |
| Fluorochem | 10g | 91.65 Pln | |
| Fluorochem | 25g | 96.86 Pln | |
| Fluorochem | 50g | 138.51 Pln | |
| Fluorochem | 100g | 190.58 Pln | |
| Fluorochem | 500g | 737.26 Pln | |
| Fluorochem | 1kg | 1185.02 Pln |
properties
| purity | 97% |
|---|---|
| delivery time | 1-2 weeks |
1,3-dibromo-5-nitrobenzene (CAS 6311-60-0) is a chemical compound with the molecular formula C6H3Br2NO2 and a molecular weight of 280.90 g/mol. IUPAC name: 1,3-dibromo-5-nitrobenzene. InChIKey: ZWBHGBWABMAWOV-UHFFFAOYSA-N.
| Molecular formula | C6H3Br2NO2 |
|---|---|
| Molecular weight | 280.90 g/mol |
| IUPAC name | 1,3-dibromo-5-nitrobenzene |
| InChIKey | ZWBHGBWABMAWOV-UHFFFAOYSA-N |
| SMILES | C1=C(C=C(C=C1Br)Br)[N+](=O)[O-] |
Computed by PubChem (NCBI)