1,3-dibromo-5-nitrobenzene, 95%, 95%
cas: 6311-60-0 — see every product listed under this CAS number, including other names
1,3-dibromo-5-nitrobenzene, 95%, 95% (CAS 6311-60-0) is a chemical reagent available from Chemat. Available pack sizes: 1kg, 1g, 5g, 10g, 25g, 100g, 500g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch1149KN-1kg |
| cas | 6311-60-0 |
| size | 1kg |
| availability | 5000g |
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Chemat | 1kg | 1595.60 Pln | |
| Chemat | 1g | 74.00 Pln | |
| Chemat | 5g | 78.80 Pln | |
| Chemat | 10g | 88.40 Pln | |
| Chemat | 25g | 107.60 Pln | |
| Chemat | 100g | 213.20 Pln | |
| Chemat | 500g | 840.00 Pln |
properties
| purity | 95% |
|---|---|
| delivery time | 3 weeks |
1,3-dibromo-5-nitrobenzene (CAS 6311-60-0) is a chemical compound with the molecular formula C6H3Br2NO2 and a molecular weight of 280.90 g/mol. IUPAC name: 1,3-dibromo-5-nitrobenzene. InChIKey: ZWBHGBWABMAWOV-UHFFFAOYSA-N.
| Molecular formula | C6H3Br2NO2 |
|---|---|
| Molecular weight | 280.90 g/mol |
| IUPAC name | 1,3-dibromo-5-nitrobenzene |
| InChIKey | ZWBHGBWABMAWOV-UHFFFAOYSA-N |
| SMILES | C1=C(C=C(C=C1Br)Br)[N+](=O)[O-] |
Computed by PubChem (NCBI)