cas: 15298-58-5 — see every product listed under this CAS number, including other names
1,4-Dichloroisoquinoline, 97% (CAS 15298-58-5) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 10g, 25g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F077801-1G |
| cas | 15298-58-5 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 1g | 143.72 Pln | |
| Fluorochem | 5g | 497.76 Pln | |
| Fluorochem | 10g | 935.11 Pln | |
| Fluorochem | 25g | 2252.35 Pln |
| purity | 97% |
|---|---|
| delivery time | 1-2 weeks |
1,4-dichloroisoquinoline (CAS 15298-58-5) is a chemical compound with the molecular formula C9H5Cl2N and a molecular weight of 198.05 g/mol. IUPAC name: 1,4-dichloroisoquinoline. InChIKey: HAOKHVBZPIURMZ-UHFFFAOYSA-N.
| Molecular formula | C9H5Cl2N |
|---|---|
| Molecular weight | 198.05 g/mol |
| IUPAC name | 1,4-dichloroisoquinoline |
| InChIKey | HAOKHVBZPIURMZ-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C(=CN=C2Cl)Cl |
Computed by PubChem (NCBI)