cas: 4752-10-7 — see every product listed under this CAS number, including other names
1,4-Dichlorophthalazine, >95.0%(GC) (CAS 4752-10-7) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g. Offered by: TCI.
| brand | TCI |
|---|---|
| catalog number | D3749-1G |
| cas | 4752-10-7 |
| size | 1g |
| availability | 2 tygodnie|2 weeks |
| brand | size | price | |
|---|---|---|---|
| TCI | 1g | 123.26 Pln | |
| TCI | 5g | 418.30 Pln |
| delivery time | 2 weeks |
|---|---|
| category | chemicals |
| purity | >95.0%(GC) |
1,4-dichlorophthalazine (CAS 4752-10-7) is a chemical compound with the molecular formula C8H4Cl2N2 and a molecular weight of 199.03 g/mol. IUPAC name: 1,4-dichlorophthalazine. InChIKey: ODCNAEMHGMYADO-UHFFFAOYSA-N.
| Molecular formula | C8H4Cl2N2 |
|---|---|
| Molecular weight | 199.03 g/mol |
| IUPAC name | 1,4-dichlorophthalazine |
| InChIKey | ODCNAEMHGMYADO-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C(=NN=C2Cl)Cl |
Computed by PubChem (NCBI)