cas: 4752-10-7 — see every product listed under this CAS number, including other names
1,4-Dichlorophthalazine, 98% (CAS 4752-10-7) is a chemical reagent available from Chemat. Available pack sizes: 25g, 5g, 1g, 10g, 100g, 500g. Offered by: AmBeed, Fluorochem.
| brand | AmBeed |
|---|---|
| catalog number | A207122-25g |
| cas | 4752-10-7 |
| size | 25g |
| availability | Synthetic Items: 0g |
| brand | size | price | |
|---|---|---|---|
| AmBeed | 25g | 304.36 Pln | |
| AmBeed | 5g | 148.12 Pln | |
| Fluorochem | 1g | 91.65 Pln | |
| Fluorochem | 5g | 91.65 Pln | |
| Fluorochem | 10g | 107.27 Pln | |
| Fluorochem | 25g | 190.58 Pln | |
| Fluorochem | 100g | 476.93 Pln | |
| Fluorochem | 500g | 1695.25 Pln |
| purity | 98% |
|---|---|
| delivery time | To be confirmed by Chemat |
1,4-dichlorophthalazine (CAS 4752-10-7) is a chemical compound with the molecular formula C8H4Cl2N2 and a molecular weight of 199.03 g/mol. IUPAC name: 1,4-dichlorophthalazine. InChIKey: ODCNAEMHGMYADO-UHFFFAOYSA-N.
| Molecular formula | C8H4Cl2N2 |
|---|---|
| Molecular weight | 199.03 g/mol |
| IUPAC name | 1,4-dichlorophthalazine |
| InChIKey | ODCNAEMHGMYADO-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C(=NN=C2Cl)Cl |
Computed by PubChem (NCBI)