cas: 78754-94-6 — see every product listed under this CAS number, including other names
1,4-Dihydro-2,4-dioxo-3(2H)-quinazolineaceticacid, 97%, 97% (CAS 78754-94-6) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch116JUG-100mg |
| cas | 78754-94-6 |
| size | 100mg |
| availability | 2g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 496.40 Pln | |
| Chemat | 250mg | 971.60 Pln | |
| Chemat | 1g | 2978.00 Pln |
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
2-(2,4-dioxo-1H-quinazolin-3-yl)acetic acid (CAS 78754-94-6) is a chemical compound with the molecular formula C10H8N2O4 and a molecular weight of 220.18 g/mol. IUPAC name: 2-(2,4-dioxo-1H-quinazolin-3-yl)acetic acid. InChIKey: RQQGYSJFFRKGNY-UHFFFAOYSA-N.
| Molecular formula | C10H8N2O4 |
|---|---|
| Molecular weight | 220.18 g/mol |
| IUPAC name | 2-(2,4-dioxo-1H-quinazolin-3-yl)acetic acid |
| InChIKey | RQQGYSJFFRKGNY-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C(=O)N(C(=O)N2)CC(=O)O |
Computed by PubChem (NCBI)