cas: 495-71-6 — see every product listed under this CAS number, including other names
1,4-Diphenylbutane-1,4-dione 98% (CAS 495-71-6) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 25g, 100g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A148974-1g |
| cas | 495-71-6 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 1g | 298.06 Pln | |
| Ambeed | 5g | 793.12 Pln | |
| Ambeed | 25g | 2639.88 Pln | |
| Ambeed | 100g | 8558.38 Pln |
| purity | 98% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A148974 |
1,4-diphenylbutane-1,4-dione (CAS 495-71-6) is a chemical compound with the molecular formula C16H14O2 and a molecular weight of 238.28 g/mol. IUPAC name: 1,4-diphenylbutane-1,4-dione. InChIKey: OSWWFLDIIGGSJV-UHFFFAOYSA-N.
| Molecular formula | C16H14O2 |
|---|---|
| Molecular weight | 238.28 g/mol |
| IUPAC name | 1,4-diphenylbutane-1,4-dione |
| InChIKey | OSWWFLDIIGGSJV-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C(=O)CCC(=O)C2=CC=CC=C2 |
Computed by PubChem (NCBI)