cas: 495-71-6 — see every product listed under this CAS number, including other names
1,4-Diphenylbutane-1,4-dione, 98%, 98% (CAS 495-71-6) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 10g, 25g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch1143KM-250mg |
| cas | 495-71-6 |
| size | 250mg |
| availability | 50g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 250mg | 98.00 Pln | |
| Chemat | 1g | 136.40 Pln | |
| Chemat | 5g | 309.20 Pln | |
| Chemat | 10g | 539.60 Pln | |
| Chemat | 25g | 1048.40 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
1,4-diphenylbutane-1,4-dione (CAS 495-71-6) is a chemical compound with the molecular formula C16H14O2 and a molecular weight of 238.28 g/mol. IUPAC name: 1,4-diphenylbutane-1,4-dione. InChIKey: OSWWFLDIIGGSJV-UHFFFAOYSA-N.
| Molecular formula | C16H14O2 |
|---|---|
| Molecular weight | 238.28 g/mol |
| IUPAC name | 1,4-diphenylbutane-1,4-dione |
| InChIKey | OSWWFLDIIGGSJV-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C(=O)CCC(=O)C2=CC=CC=C2 |
Computed by PubChem (NCBI)