cas: 1459205-36-7 — see every product listed under this CAS number, including other names
1–(4–(Aminomethyl)phenyl)pyridin–1–ium chloride (CAS 1459205-36-7) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 1g, 250mg. Offered by: GLPBio.
| brand | GLPBio |
|---|---|
| catalog number | GF46745-100mg |
| cas | 1459205-36-7 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| GLPBio | 100mg | 1706.32 Pln | |
| GLPBio | 1g | 4931.18 Pln | |
| GLPBio | 250mg | 2675.18 Pln |
| purity | No data |
|---|---|
| delivery time | To be confirmed by Chemat |
(4-pyridin-1-ium-1-ylphenyl)methanamine chloride (CAS 1459205-36-7) is a chemical compound with the molecular formula C12H13ClN2 and a molecular weight of 220.70 g/mol. IUPAC name: (4-pyridin-1-ium-1-ylphenyl)methanamine chloride. InChIKey: IWJUNRJXBXYTMP-UHFFFAOYSA-M.
| Molecular formula | C12H13ClN2 |
|---|---|
| Molecular weight | 220.70 g/mol |
| IUPAC name | (4-pyridin-1-ium-1-ylphenyl)methanamine chloride |
| InChIKey | IWJUNRJXBXYTMP-UHFFFAOYSA-M |
| SMILES | C1=CC=[N+](C=C1)C2=CC=C(C=C2)CN.[Cl-] |
Computed by PubChem (NCBI)