CAS 2241128-64-1 appears in our catalog under these names: rac-(1R,2S)-2-(3,5-Dichlorophenyl)cyclopropan-1-amine hydrochloride, rac-(1R,2S)-2-(3,5-dichlorophenyl)cyclopropan-1-amine hydrochloride, 95%, 95%. Offered by: Biosynth, Chemat. Available pack sizes: 50mg, 0,5g, 1g.
Trans-(1R,2S)-2-(3,5-dichlorophenyl)cyclopropan-1-amine;hydrochloride (CAS 2241128-64-1) is a chemical compound with the molecular formula C9H10Cl3N and a molecular weight of 238.5 g/mol. IUPAC name: trans-(1R,2S)-2-(3,5-dichlorophenyl)cyclopropan-1-amine;hydrochloride. InChIKey: KBNZYWIMKGSXFQ-OULXEKPRSA-N.
| Molecular formula | C9H10Cl3N |
|---|---|
| Molecular weight | 238.5 g/mol |
| IUPAC name | trans-(1R,2S)-2-(3,5-dichlorophenyl)cyclopropan-1-amine;hydrochloride |
| InChIKey | KBNZYWIMKGSXFQ-OULXEKPRSA-N |
| SMILES | C1[C@H]([C@@H]1N)C2=CC(=CC(=C2)Cl)Cl.Cl |
Computed by PubChem (NCBI)