cas: 1020056-98-7 — see every product listed under this CAS number, including other names
2,3-Dibromoisonicotinic acid, 98%+(HPLC),RG, 98%+(HPLC),RG (CAS 1020056-98-7) is a chemical reagent available from Chemat. Available pack sizes: 250mg. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch1117AH-250mg |
| cas | 1020056-98-7 |
| size | 250mg |
| availability | 0.25g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 250mg | 160.40 Pln |
| purity | 98%+(HPLC),RG |
|---|---|
| delivery time | 3 weeks |
2,3-dibromopyridine-4-carboxylic acid (CAS 1020056-98-7) is a chemical compound with the molecular formula C6H3Br2NO2 and a molecular weight of 280.90 g/mol. IUPAC name: 2,3-dibromopyridine-4-carboxylic acid. InChIKey: ICISUZSRQHUJKX-UHFFFAOYSA-N.
| Molecular formula | C6H3Br2NO2 |
|---|---|
| Molecular weight | 280.90 g/mol |
| IUPAC name | 2,3-dibromopyridine-4-carboxylic acid |
| InChIKey | ICISUZSRQHUJKX-UHFFFAOYSA-N |
| SMILES | C1=CN=C(C(=C1C(=O)O)Br)Br |
Computed by PubChem (NCBI)