cas: 1020056-98-7 — see every product listed under this CAS number, including other names
2,3-Dibromopyridine-4-carboxylic acid (CAS 1020056-98-7) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F047654-250MG |
| cas | 1020056-98-7 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 250mg | 294.71 Pln | |
| Fluorochem | 1g | 778.91 Pln |
| delivery time | 3-4 weeks |
|---|
2,3-dibromopyridine-4-carboxylic acid (CAS 1020056-98-7) is a chemical compound with the molecular formula C6H3Br2NO2 and a molecular weight of 280.90 g/mol. IUPAC name: 2,3-dibromopyridine-4-carboxylic acid. InChIKey: ICISUZSRQHUJKX-UHFFFAOYSA-N.
| Molecular formula | C6H3Br2NO2 |
|---|---|
| Molecular weight | 280.90 g/mol |
| IUPAC name | 2,3-dibromopyridine-4-carboxylic acid |
| InChIKey | ICISUZSRQHUJKX-UHFFFAOYSA-N |
| SMILES | C1=CN=C(C(=C1C(=O)O)Br)Br |
Computed by PubChem (NCBI)