cas: 4442-53-9 — see every product listed under this CAS number, including other names
2,3-Dihydrobenzo[b][1,4]dioxine-5-carboxylic acid 97% (CAS 4442-53-9) is a chemical reagent available from Chemat. Available pack sizes: 1g, 10g, 25g, 100g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A163137-1g |
| cas | 4442-53-9 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 1g | 120.06 Pln | |
| Ambeed | 10g | 192.38 Pln | |
| Ambeed | 25g | 292.50 Pln | |
| Ambeed | 100g | 943.31 Pln |
| purity | 97% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A163137 |
2,3-dihydro-1,4-benzodioxine-5-carboxylic acid (CAS 4442-53-9) is a chemical compound with the molecular formula C9H8O4 and a molecular weight of 180.16 g/mol. IUPAC name: 2,3-dihydro-1,4-benzodioxine-5-carboxylic acid. InChIKey: VCLSWKVAHAJSFL-UHFFFAOYSA-N.
| Molecular formula | C9H8O4 |
|---|---|
| Molecular weight | 180.16 g/mol |
| IUPAC name | 2,3-dihydro-1,4-benzodioxine-5-carboxylic acid |
| InChIKey | VCLSWKVAHAJSFL-UHFFFAOYSA-N |
| SMILES | C1COC2=C(C=CC=C2O1)C(=O)O |
Computed by PubChem (NCBI)