cas: 7149-49-7 — see every product listed under this CAS number, including other names
2,3-Naphthalenedicarboxaldehyde, 95% (CAS 7149-49-7) is a chemical reagent available from Chemat. Available pack sizes: 500MG, 100MG, 250mg, 1g. Offered by: Thermo Scientific (Acros), Fluorochem.
| brand | Thermo Scientific (Acros) |
|---|---|
| catalog number | 294725000 |
| cas | 7149-49-7 |
| size | 500MG |
| availability | availability |
| brand | size | price | |
|---|---|---|---|
| Thermo Scientific (Acros) | 500MG | 2071.32 Pln | |
| Thermo Scientific (Acros) | 100MG | 587.99 Pln | |
| Fluorochem | 100mg | 216.61 Pln | |
| Fluorochem | 250mg | 393.63 Pln | |
| Fluorochem | 1g | 1185.02 Pln |
| delivery time | 2-3 weeks |
|---|---|
| category | Chemicals |
| purity | 95% |
Naphthalene-2,3-dicarbaldehyde (CAS 7149-49-7) is a chemical compound with the molecular formula C12H8O2 and a molecular weight of 184.19 g/mol. IUPAC name: naphthalene-2,3-dicarbaldehyde. InChIKey: ZIPLKLQPLOWLTM-UHFFFAOYSA-N.
| Molecular formula | C12H8O2 |
|---|---|
| Molecular weight | 184.19 g/mol |
| IUPAC name | naphthalene-2,3-dicarbaldehyde |
| InChIKey | ZIPLKLQPLOWLTM-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C=C(C(=CC2=C1)C=O)C=O |
Computed by PubChem (NCBI)