cas: 7149-49-7 — see every product listed under this CAS number, including other names
2,3-Naphthalenedicarboxaldehyde, 98%, 98% (CAS 7149-49-7) is a chemical reagent available from Chemat. Available pack sizes: 25mg, 100mg, 250mg, 1g, 5g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch114FKY-25mg |
| cas | 7149-49-7 |
| size | 25mg |
| availability | 10g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 25mg | 126.80 Pln | |
| Chemat | 100mg | 146.00 Pln | |
| Chemat | 250mg | 256.40 Pln | |
| Chemat | 1g | 832.40 Pln | |
| Chemat | 5g | 3021.20 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
Naphthalene-2,3-dicarbaldehyde (CAS 7149-49-7) is a chemical compound with the molecular formula C12H8O2 and a molecular weight of 184.19 g/mol. IUPAC name: naphthalene-2,3-dicarbaldehyde. InChIKey: ZIPLKLQPLOWLTM-UHFFFAOYSA-N.
| Molecular formula | C12H8O2 |
|---|---|
| Molecular weight | 184.19 g/mol |
| IUPAC name | naphthalene-2,3-dicarbaldehyde |
| InChIKey | ZIPLKLQPLOWLTM-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C=C(C(=CC2=C1)C=O)C=O |
Computed by PubChem (NCBI)