cas: 7149-49-7 — see every product listed under this CAS number, including other names
Naphthalene-2,3-Dicarboxaldehyde, 99.83% (CAS 7149-49-7) is a chemical reagent available from Chemat. Available pack sizes: 1 g, 100 mg, 250 mg, 50 mg, 500 mg. Offered by: MedChemExpress.
| brand | MedChemExpress |
|---|---|
| catalog number | HY-W016288-1 g |
| cas | 7149-49-7 |
| size | 1 g |
| availability | In stock |
| brand | size | price | |
|---|---|---|---|
| MedChemExpress | 1 g | 3189.68 Pln | |
| MedChemExpress | 100 mg | 649.42 Pln | |
| MedChemExpress | 250 mg | 1318.15 Pln | |
| MedChemExpress | 50 mg | 431.15 Pln | |
| MedChemExpress | 500 mg | 2037.97 Pln |
| delivery time | 1-2 weeks |
|---|---|
| purity | 99.83% |
Naphthalene-2,3-dicarbaldehyde (CAS 7149-49-7) is a chemical compound with the molecular formula C12H8O2 and a molecular weight of 184.19 g/mol. IUPAC name: naphthalene-2,3-dicarbaldehyde. InChIKey: ZIPLKLQPLOWLTM-UHFFFAOYSA-N.
| Molecular formula | C12H8O2 |
|---|---|
| Molecular weight | 184.19 g/mol |
| IUPAC name | naphthalene-2,3-dicarbaldehyde |
| InChIKey | ZIPLKLQPLOWLTM-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C=C(C(=CC2=C1)C=O)C=O |
Computed by PubChem (NCBI)