cas: 7149-49-7 — see every product listed under this CAS number, including other names
2,3-Naphthalenedicarboxaldehyde (CAS 7149-49-7) is a chemical reagent available from Chemat. Available pack sizes: 25mg, 50mg, 100mg, 500mg. Offered by: TargetMol.
| brand | TargetMol |
|---|---|
| catalog number | T67771-25mg |
| cas | 7149-49-7 |
| size | 25mg |
| brand | size | price | |
|---|---|---|---|
| TargetMol | 25mg | 432.54 Pln | |
| TargetMol | 50mg | 525.34 Pln | |
| TargetMol | 100mg | 757.88 Pln | |
| TargetMol | 500mg | 1581.29 Pln |
| purity | No data |
|---|---|
| delivery time | approx. 33 days |
Naphthalene-2,3-dicarbaldehyde (CAS 7149-49-7) is a chemical compound with the molecular formula C12H8O2 and a molecular weight of 184.19 g/mol. IUPAC name: naphthalene-2,3-dicarbaldehyde. InChIKey: ZIPLKLQPLOWLTM-UHFFFAOYSA-N.
| Molecular formula | C12H8O2 |
|---|---|
| Molecular weight | 184.19 g/mol |
| IUPAC name | naphthalene-2,3-dicarbaldehyde |
| InChIKey | ZIPLKLQPLOWLTM-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C=C(C(=CC2=C1)C=O)C=O |
Computed by PubChem (NCBI)