cas: 7149-49-7 — see every product listed under this CAS number, including other names
Naphthalene-2,3-Dicarboxaldehyde 99% (CAS 7149-49-7) is a chemical reagent available from Chemat. Available pack sizes: 10g, 100mg, 250mg, 1g, 5g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A770576-10g |
| cas | 7149-49-7 |
| size | 10g |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 10g | 6978.62 Pln | |
| Ambeed | 100mg | 292.50 Pln | |
| Ambeed | 250mg | 481.62 Pln | |
| Ambeed | 1g | 1193.62 Pln | |
| Ambeed | 5g | 4386.50 Pln |
| purity | 99% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A770576 |
Naphthalene-2,3-dicarbaldehyde (CAS 7149-49-7) is a chemical compound with the molecular formula C12H8O2 and a molecular weight of 184.19 g/mol. IUPAC name: naphthalene-2,3-dicarbaldehyde. InChIKey: ZIPLKLQPLOWLTM-UHFFFAOYSA-N.
| Molecular formula | C12H8O2 |
|---|---|
| Molecular weight | 184.19 g/mol |
| IUPAC name | naphthalene-2,3-dicarbaldehyde |
| InChIKey | ZIPLKLQPLOWLTM-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C=C(C(=CC2=C1)C=O)C=O |
Computed by PubChem (NCBI)