cas: 28252-82-6 — see every product listed under this CAS number, including other names
2,4-Dichloro-1,5-naphthyridine 95% (CAS 28252-82-6) is a chemical reagent available from Chemat. Available pack sizes: 50mg, 100mg, 250mg, 1g, 5g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A156853-50mg |
| cas | 28252-82-6 |
| size | 50mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 50mg | 681.88 Pln | |
| Ambeed | 100mg | 1104.63 Pln | |
| Ambeed | 250mg | 1827.75 Pln | |
| Ambeed | 1g | 5326.56 Pln | |
| Ambeed | 5g | 15094.31 Pln |
| purity | 95% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A156853 |
2,4-dichloro-1,5-naphthyridine (CAS 28252-82-6) is a chemical compound with the molecular formula C8H4Cl2N2 and a molecular weight of 199.03 g/mol. IUPAC name: 2,4-dichloro-1,5-naphthyridine. InChIKey: BXXUGCOGJVNBKY-UHFFFAOYSA-N.
| Molecular formula | C8H4Cl2N2 |
|---|---|
| Molecular weight | 199.03 g/mol |
| IUPAC name | 2,4-dichloro-1,5-naphthyridine |
| InChIKey | BXXUGCOGJVNBKY-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C(=CC(=N2)Cl)Cl)N=C1 |
Computed by PubChem (NCBI)