cas: 39551-54-7 — see every product listed under this CAS number, including other names
2,4-Dichloropyrido[3,2-d]pyrimidine, 98% (CAS 39551-54-7) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 2g, 5g, 8g, 10g, 25g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F075764-250MG |
| cas | 39551-54-7 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 250mg | 164.54 Pln | |
| Fluorochem | 1g | 357.18 Pln | |
| Fluorochem | 2g | 659.16 Pln | |
| Fluorochem | 5g | 1408.90 Pln | |
| Fluorochem | 8g | 1716.08 Pln | |
| Fluorochem | 10g | 2127.39 Pln | |
| Fluorochem | 25g | 5225.26 Pln |
| purity | 98% |
|---|---|
| delivery time | 3-4 weeks |
2,4-dichloropyrido[3,2-d]pyrimidine (CAS 39551-54-7) is a chemical compound with the molecular formula C7H3Cl2N3 and a molecular weight of 200.02 g/mol. IUPAC name: 2,4-dichloropyrido[3,2-d]pyrimidine. InChIKey: UVVFNZJVLRJSMW-UHFFFAOYSA-N.
| Molecular formula | C7H3Cl2N3 |
|---|---|
| Molecular weight | 200.02 g/mol |
| IUPAC name | 2,4-dichloropyrido[3,2-d]pyrimidine |
| InChIKey | UVVFNZJVLRJSMW-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C(=NC(=N2)Cl)Cl)N=C1 |
Computed by PubChem (NCBI)