CAS 126728-20-9 appears in our catalog under these names: 2,4-Dichloropyrido (2,3-D) pyrimidine, 2,4-Dichloropyrido[2,3-d]pyrimidine 98%, 2,4-dichloropyrido(2,3-d)pyrimidine, 98%, 98%, 2,4-Dichloropyrido[2,3-d]pyrimidine, 98%. Offered by: Biosynth, Ambeed, Chemat, Fluorochem. Available pack sizes: 50g, 100mg, 250mg, 1g, 5g, 25g, 100g, 10g.
2,4-dichloropyrido[2,3-d]pyrimidine (CAS 126728-20-9) is a chemical compound with the molecular formula C7H3Cl2N3 and a molecular weight of 200.02 g/mol. IUPAC name: 2,4-dichloropyrido[2,3-d]pyrimidine. InChIKey: QSNSZGYDLUPWSV-UHFFFAOYSA-N.
| Molecular formula | C7H3Cl2N3 |
|---|---|
| Molecular weight | 200.02 g/mol |
| IUPAC name | 2,4-dichloropyrido[2,3-d]pyrimidine |
| InChIKey | QSNSZGYDLUPWSV-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(N=C1)N=C(N=C2Cl)Cl |
Computed by PubChem (NCBI)