CAS 2387158-74-7 is the registry number for 2,7-Dichloropyrido(4,3-d)pyrimidine, 97%. Offered by: AmBeed. Available pack sizes: 5g, 1g, 250mg, 100mg.
2,7-dichloropyrido[4,3-d]pyrimidine (CAS 2387158-74-7) is a chemical compound with the molecular formula C7H3Cl2N3 and a molecular weight of 200.02 g/mol. IUPAC name: 2,7-dichloropyrido[4,3-d]pyrimidine. InChIKey: GSBIMIXIPDBUHJ-UHFFFAOYSA-N.
| Molecular formula | C7H3Cl2N3 |
|---|---|
| Molecular weight | 200.02 g/mol |
| IUPAC name | 2,7-dichloropyrido[4,3-d]pyrimidine |
| InChIKey | GSBIMIXIPDBUHJ-UHFFFAOYSA-N |
| SMILES | C1=C2C(=CN=C1Cl)C=NC(=N2)Cl |
Computed by PubChem (NCBI)