CAS 908240-50-6 appears in our catalog under these names: 2,4-Dichloropyrido(3,4-d)pyrimidine, 95-<97%, 2,4-Dichloropyrido(3,4-d)pyrimidine, ≥97-<99%, 2,4-Dichloropyrido[3,4-d]pyrimidine, 95%, 95%, 2,4-Dichloropyrido[3,4-d]pyrimidine, 95%. Offered by: Hoffman Fine Chemicals, Chemat, Fluorochem, Ambeed. Available pack sizes: 2,5g, 5g, 10g, 25g, 50g, 100mg, 250mg, 1g.
2,4-dichloropyrido[3,4-d]pyrimidine (CAS 908240-50-6) is a chemical compound with the molecular formula C7H3Cl2N3 and a molecular weight of 200.02 g/mol. IUPAC name: 2,4-dichloropyrido[3,4-d]pyrimidine. InChIKey: YJUVYWACDUJBDG-UHFFFAOYSA-N.
| Molecular formula | C7H3Cl2N3 |
|---|---|
| Molecular weight | 200.02 g/mol |
| IUPAC name | 2,4-dichloropyrido[3,4-d]pyrimidine |
| InChIKey | YJUVYWACDUJBDG-UHFFFAOYSA-N |
| SMILES | C1=CN=CC2=C1C(=NC(=N2)Cl)Cl |
Computed by PubChem (NCBI)