CAS 746671-61-4 is the registry number for 4,6-Dichloropyrido[2,3-d]pyrimidine, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
4,6-dichloropyrido[2,3-d]pyrimidine (CAS 746671-61-4) is a chemical compound with the molecular formula C7H3Cl2N3 and a molecular weight of 200.02 g/mol. IUPAC name: 4,6-dichloropyrido[2,3-d]pyrimidine. InChIKey: UIWQZHNOVPDFTA-UHFFFAOYSA-N.
| Molecular formula | C7H3Cl2N3 |
|---|---|
| Molecular weight | 200.02 g/mol |
| IUPAC name | 4,6-dichloropyrido[2,3-d]pyrimidine |
| InChIKey | UIWQZHNOVPDFTA-UHFFFAOYSA-N |
| SMILES | C1=C(C=NC2=C1C(=NC=N2)Cl)Cl |
Computed by PubChem (NCBI)