CAS 14490-19-8 appears in our catalog under these names: 1,4-Dichloropyrido[3,4-d]pyridazine, 98%, 98%, 1,4-Dichloropyrido[4,3-d]pyridazine, 97%, 1,4-Dichloropyrido[3,4-d]pyridazine, 97%. Offered by: Chemat, Fluorochem, Ambeed. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g, 25g, 50g.
1,4-dichloropyrido[3,4-d]pyridazine (CAS 14490-19-8) is a chemical compound with the molecular formula C7H3Cl2N3 and a molecular weight of 200.02 g/mol. IUPAC name: 1,4-dichloropyrido[3,4-d]pyridazine. InChIKey: LMVNXZZDBBSCSG-UHFFFAOYSA-N.
| Molecular formula | C7H3Cl2N3 |
|---|---|
| Molecular weight | 200.02 g/mol |
| IUPAC name | 1,4-dichloropyrido[3,4-d]pyridazine |
| InChIKey | LMVNXZZDBBSCSG-UHFFFAOYSA-N |
| SMILES | C1=CN=CC2=C1C(=NN=C2Cl)Cl |
Computed by PubChem (NCBI)