CAS 1379338-74-5 appears in our catalog under these names: 5,7-Dichloropyrido[3,4-b]pyrazine, 98%, 98%, 5,7-DICHLOROPYRIDO[3,4-B]PYRAZINE, 95%, 5,7-Dichloropyrido[3,4-b]pyrazine, 97%. Offered by: Chemat, Fluorochem, Ambeed. Available pack sizes: 10g, 100mg, 250mg, 1g, 5g.
5,7-dichloropyrido[3,4-b]pyrazine (CAS 1379338-74-5) is a chemical compound with the molecular formula C7H3Cl2N3 and a molecular weight of 200.02 g/mol. IUPAC name: 5,7-dichloropyrido[3,4-b]pyrazine. InChIKey: SNWNPXRUXXCDOM-UHFFFAOYSA-N.
| Molecular formula | C7H3Cl2N3 |
|---|---|
| Molecular weight | 200.02 g/mol |
| IUPAC name | 5,7-dichloropyrido[3,4-b]pyrazine |
| InChIKey | SNWNPXRUXXCDOM-UHFFFAOYSA-N |
| SMILES | C1=CN=C2C(=N1)C=C(N=C2Cl)Cl |
Computed by PubChem (NCBI)