cas: 607-68-1 — see every product listed under this CAS number, including other names
2,4-Dichloroquinazoline, 95% (CAS 607-68-1) is a chemical reagent available from Chemat. Available pack sizes: 25g, 500g, 5g, 1g, 100g, 10g, 50g. Offered by: Combi-blocks, Fluorochem.
| brand | Combi-blocks |
|---|---|
| catalog number | OR-1735-25g |
| cas | 607-68-1 |
| size | 25g |
| brand | size | price | |
|---|---|---|---|
| Combi-blocks | 25g | price on request | |
| Combi-blocks | 500g | price on request | |
| Combi-blocks | 5g | price on request | |
| Combi-blocks | 1g | price on request | |
| Combi-blocks | 100g | price on request | |
| Fluorochem | 1g | 81.24 Pln | |
| Fluorochem | 5g | 112.48 Pln | |
| Fluorochem | 10g | 159.34 Pln | |
| Fluorochem | 25g | 258.26 Pln | |
| Fluorochem | 50g | 456.11 Pln | |
| Fluorochem | 100g | 841.39 Pln | |
| Fluorochem | 500g | 3548.77 Pln |
| purity | 95% |
|---|---|
| delivery time | 1-2 weeks (only if in stock, to check click on availability) |
2,4-dichloroquinazoline (CAS 607-68-1) is a chemical compound with the molecular formula C8H4Cl2N2 and a molecular weight of 199.03 g/mol. IUPAC name: 2,4-dichloroquinazoline. InChIKey: TUQSVSYUEBNNKQ-UHFFFAOYSA-N.
| Molecular formula | C8H4Cl2N2 |
|---|---|
| Molecular weight | 199.03 g/mol |
| IUPAC name | 2,4-dichloroquinazoline |
| InChIKey | TUQSVSYUEBNNKQ-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C(=NC(=N2)Cl)Cl |
Computed by PubChem (NCBI)