cas: 607-68-1 — see every product listed under this CAS number, including other names
2,4-Dichloroquinazoline, 97%, 97% (CAS 607-68-1) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 10g, 25g, 100g, 500g, 1kg, 5kg. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch1143ZB-1g |
| cas | 607-68-1 |
| size | 1g |
| availability | 10000g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 1g | 78.80 Pln | |
| Chemat | 5g | 98.00 Pln | |
| Chemat | 10g | 136.40 Pln | |
| Chemat | 25g | 237.20 Pln | |
| Chemat | 100g | 702.80 Pln | |
| Chemat | 500g | 3028.80 Pln | |
| Chemat | 1kg | 3184.40 Pln | |
| Chemat | 5kg | 15969.60 Pln | |
| Chemat | 10kg | price on request |
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
2,4-dichloroquinazoline (CAS 607-68-1) is a chemical compound with the molecular formula C8H4Cl2N2 and a molecular weight of 199.03 g/mol. IUPAC name: 2,4-dichloroquinazoline. InChIKey: TUQSVSYUEBNNKQ-UHFFFAOYSA-N.
| Molecular formula | C8H4Cl2N2 |
|---|---|
| Molecular weight | 199.03 g/mol |
| IUPAC name | 2,4-dichloroquinazoline |
| InChIKey | TUQSVSYUEBNNKQ-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C(=NC(=N2)Cl)Cl |
Computed by PubChem (NCBI)