2,5-Dibromonicotinic acid 97%
cas: 29312-99-0 — see every product listed under this CAS number, including other names
2,5-Dibromonicotinic acid 97% (CAS 29312-99-0) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 10g, 25g, 100g, 500g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A354726-250mg |
| cas | 29312-99-0 |
| size | 250mg |
Documents:
Safety Data Sheet (MSDS)
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 131.19 Pln | |
| Ambeed | 1g | 147.88 Pln | |
| Ambeed | 5g | 275.81 Pln | |
| Ambeed | 10g | 381.50 Pln | |
| Ambeed | 25g | 698.56 Pln | |
| Ambeed | 100g | 1955.69 Pln | |
| Ambeed | 500g | 9492.88 Pln |
properties
| purity | 97% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A354726 |
2,5-dibromopyridine-3-carboxylic acid (CAS 29312-99-0) is a chemical compound with the molecular formula C6H3Br2NO2 and a molecular weight of 280.90 g/mol. IUPAC name: 2,5-dibromopyridine-3-carboxylic acid. InChIKey: BRPWRSWAXHWEPS-UHFFFAOYSA-N.
| Molecular formula | C6H3Br2NO2 |
|---|---|
| Molecular weight | 280.90 g/mol |
| IUPAC name | 2,5-dibromopyridine-3-carboxylic acid |
| InChIKey | BRPWRSWAXHWEPS-UHFFFAOYSA-N |
| SMILES | C1=C(C=NC(=C1C(=O)O)Br)Br |
Computed by PubChem (NCBI)