cas: 2468045-30-7 — see every product listed under this CAS number, including other names
2,5-Dimethoxy-4-formylphenylboronic acid, 97% (CAS 2468045-30-7) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F627259-100MG |
| cas | 2468045-30-7 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 100mg | 320.74 Pln | |
| Fluorochem | 250mg | 487.35 Pln | |
| Fluorochem | 1g | 981.96 Pln | |
| Fluorochem | 5g | 3392.57 Pln |
| purity | 97% |
|---|---|
| delivery time | 3-4 weeks |
(4-formyl-2,5-dimethoxyphenyl)boronic acid (CAS 2468045-30-7) is a chemical compound with the molecular formula C9H11BO5 and a molecular weight of 209.99 g/mol. IUPAC name: (4-formyl-2,5-dimethoxyphenyl)boronic acid. InChIKey: DTUOLKLERIMYCW-UHFFFAOYSA-N.
| Molecular formula | C9H11BO5 |
|---|---|
| Molecular weight | 209.99 g/mol |
| IUPAC name | (4-formyl-2,5-dimethoxyphenyl)boronic acid |
| InChIKey | DTUOLKLERIMYCW-UHFFFAOYSA-N |
| SMILES | B(C1=CC(=C(C=C1OC)C=O)OC)(O)O |
Computed by PubChem (NCBI)