cas: 2468045-30-7 — see every product listed under this CAS number, including other names
2,5-Dimethoxy-4-formylphenylboronic acid, 98%, 98% (CAS 2468045-30-7) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 100mg. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch12K731-250mg |
| cas | 2468045-30-7 |
| size | 250mg |
| availability | 15g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 250mg | 386.00 Pln | |
| Chemat | 1g | 736.40 Pln | |
| Chemat | 5g | 2536.40 Pln | |
| Chemat | 100mg | 251.60 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
(4-formyl-2,5-dimethoxyphenyl)boronic acid (CAS 2468045-30-7) is a chemical compound with the molecular formula C9H11BO5 and a molecular weight of 209.99 g/mol. IUPAC name: (4-formyl-2,5-dimethoxyphenyl)boronic acid. InChIKey: DTUOLKLERIMYCW-UHFFFAOYSA-N.
| Molecular formula | C9H11BO5 |
|---|---|
| Molecular weight | 209.99 g/mol |
| IUPAC name | (4-formyl-2,5-dimethoxyphenyl)boronic acid |
| InChIKey | DTUOLKLERIMYCW-UHFFFAOYSA-N |
| SMILES | B(C1=CC(=C(C=C1OC)C=O)OC)(O)O |
Computed by PubChem (NCBI)