cas: 246023-54-1 — see every product listed under this CAS number, including other names
2,5-Dimethyl-4-methoxyphenylboronic acid, 95% (CAS 246023-54-1) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 10g, 25g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F218937-1G |
| cas | 246023-54-1 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 1g | 159.34 Pln | |
| Fluorochem | 5g | 372.80 Pln | |
| Fluorochem | 10g | 690.40 Pln | |
| Fluorochem | 25g | 1002.79 Pln |
| purity | 95% |
|---|---|
| delivery time | 3-4 weeks |
(4-methoxy-2,5-dimethylphenyl)boronic acid (CAS 246023-54-1) is a chemical compound with the molecular formula C9H13BO3 and a molecular weight of 180.01 g/mol. IUPAC name: (4-methoxy-2,5-dimethylphenyl)boronic acid. InChIKey: IUUWNGBWUJVQCF-UHFFFAOYSA-N.
| Molecular formula | C9H13BO3 |
|---|---|
| Molecular weight | 180.01 g/mol |
| IUPAC name | (4-methoxy-2,5-dimethylphenyl)boronic acid |
| InChIKey | IUUWNGBWUJVQCF-UHFFFAOYSA-N |
| SMILES | B(C1=CC(=C(C=C1C)OC)C)(O)O |
Computed by PubChem (NCBI)