cas: 246023-54-1 — see every product listed under this CAS number, including other names
2,5-Dimethyl-4-methoxyphenylboronic acid, 97%, 97% (CAS 246023-54-1) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 10g, 25g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch113OQ0-250mg |
| cas | 246023-54-1 |
| size | 250mg |
| availability | 50g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 250mg | 78.80 Pln | |
| Chemat | 1g | 126.80 Pln | |
| Chemat | 5g | 371.60 Pln | |
| Chemat | 10g | 678.80 Pln | |
| Chemat | 25g | 1422.80 Pln |
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
(4-methoxy-2,5-dimethylphenyl)boronic acid (CAS 246023-54-1) is a chemical compound with the molecular formula C9H13BO3 and a molecular weight of 180.01 g/mol. IUPAC name: (4-methoxy-2,5-dimethylphenyl)boronic acid. InChIKey: IUUWNGBWUJVQCF-UHFFFAOYSA-N.
| Molecular formula | C9H13BO3 |
|---|---|
| Molecular weight | 180.01 g/mol |
| IUPAC name | (4-methoxy-2,5-dimethylphenyl)boronic acid |
| InChIKey | IUUWNGBWUJVQCF-UHFFFAOYSA-N |
| SMILES | B(C1=CC(=C(C=C1C)OC)C)(O)O |
Computed by PubChem (NCBI)